Difference between revisions of "CPD-1107"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13355 == * Synonym(s): == Reactions associated == * Reaction: RXN-11046 ** Source: orthology-esiliculosus * Reaction: [[RXN-14177]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == * smiles: ** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == |
+ | * smiles: | ||
+ | ** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1) | ||
+ | * common name: | ||
+ | ** D-myo-inositol 1,3,4,5,6-pentakisphosphate | ||
+ | * inchi key: | ||
+ | ** InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D | ||
+ | * molecular weight: | ||
+ | ** 569.977 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Ins(1,3,4,5,6)P5 | ||
+ | ** 1D-myo-inositol 1,3,4,5,6-pentakisphosphate | ||
+ | ** inositol 1,3,4,5,6-pentakisphosphate | ||
+ | ** I(1,3,4,5,6)P5 | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-10955]] |
− | * | + | * [[RXN-7163]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[2.7.1.134-RXN]] |
− | == | + | * [[2.7.1.140-RXN]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01284 C01284] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27570 27570] | ||
+ | * METABOLIGHTS : MTBLC57733 | ||
+ | * HMDB : HMDB03529 | ||
+ | {{#set: smiles=C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}} | ||
+ | {{#set: common name=D-myo-inositol 1,3,4,5,6-pentakisphosphate}} | ||
+ | {{#set: inchi key=InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D}} | ||
+ | {{#set: molecular weight=569.977 }} | ||
+ | {{#set: common name=Ins(1,3,4,5,6)P5|1D-myo-inositol 1,3,4,5,6-pentakisphosphate|inositol 1,3,4,5,6-pentakisphosphate|I(1,3,4,5,6)P5}} | ||
+ | {{#set: consumed by=RXN-10955|RXN-7163}} | ||
+ | {{#set: produced by=2.7.1.134-RXN|2.7.1.140-RXN}} |
Latest revision as of 21:25, 21 March 2018
Contents
Metabolite CPD-1107
- smiles:
- C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
- common name:
- D-myo-inositol 1,3,4,5,6-pentakisphosphate
- inchi key:
- InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D
- molecular weight:
- 569.977
- Synonym(s):
- Ins(1,3,4,5,6)P5
- 1D-myo-inositol 1,3,4,5,6-pentakisphosphate
- inositol 1,3,4,5,6-pentakisphosphate
- I(1,3,4,5,6)P5
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.