Difference between revisions of "K-HEXANOYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == * smiles: ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ETR-Quinones ETR-Quinones] == * common name: ** an electron-transfer quinone * Synonym(s): ==...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ETR-Quinones ETR-Quinones] ==
* smiles:
+
** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
+
* inchi key:
+
** InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
+
 
* common name:
 
* common name:
** nicotine-glucuronide
+
** an electron-transfer quinone
* molecular weight:
+
** 339.367   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
 +
* [[RXN-11356]]
 +
* [[RXN-11357]]
 +
* [[RXN-15745]]
 +
* [[RXN0-5259]]
 +
* [[RXN0-7230]]
 +
* [[NQOR-RXN]]
 +
* [[RXN-14903]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-83]]
+
* [[RXN-15816]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-12242]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an electron-transfer quinone}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820524 91820524]
+
{{#set: consumed by=DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN-11356|RXN-11357|RXN-15745|RXN0-5259|RXN0-7230|NQOR-RXN|RXN-14903}}
* HMDB : HMDB01272
+
{{#set: produced by=RXN-15816}}
{{#set: smiles=C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
+
{{#set: consumed or produced by=RXN-12242}}
{{#set: inchi key=InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O}}
+
{{#set: common name=nicotine-glucuronide}}
+
{{#set: molecular weight=339.367    }}
+
{{#set: produced by=RXN66-83}}
+

Revision as of 16:33, 10 January 2018

Metabolite ETR-Quinones

  • common name:
    • an electron-transfer quinone
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links