Difference between revisions of "Tiso gene 3535"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_13369 == * left end position: ** 3958 * transcription direction: ** POSITIVE * right end position: ** 4659 * centisome position: ** 62.3601...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == * smiles: ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_13369 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] ==
−
* left end position:
+
* smiles:
−
** 3958
+
** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
−
* right end position:
+
* common name:
−
** 4659
+
** nicotine-glucuronide
−
* centisome position:
+
* molecular weight:
−
** 62.36017    
+
** 339.367    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[1.3.99.23-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN66-83]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[R95]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
* [[R96]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
* [[RXN-8042]]
+
−
** in-silico_annotation
+
−
***automated-name-match
+
−
== Pathways associated ==
+
−
* [[PWY-6475]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3958}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820524 91820524]
−
{{#set: right end position=4659}}
+
* HMDB : HMDB01272
−
{{#set: centisome position=62.36017    }}
+
{{#set: smiles=C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
−
{{#set: reaction associated=1.3.99.23-RXN|R95|R96|RXN-8042}}
+
{{#set: inchi key=InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O}}
−
{{#set: pathway associated=PWY-6475}}
+
{{#set: common name=nicotine-glucuronide}}
 +
{{#set: molecular weight=339.367    }}
 +
{{#set: produced by=RXN66-83}}

Revision as of 17:34, 10 January 2018

Metabolite CPD-2744

  • smiles:
    • C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
  • inchi key:
    • InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
  • common name:
    • nicotine-glucuronide
  • molecular weight:
    • 339.367
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3535&oldid=13598"