Difference between revisions of "R00946"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-303 RXN66-303] == * direction: ** LEFT-TO-RIGHT * common name: ** lanosterol 14-hydroxylase *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-303 RXN66-303] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** lanosterol 14-hydroxylase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[LANOSTEROL]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[CPD-4568]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 NADPH[c] '''+''' 1 oxygen[c] '''+''' 1 H+[c] '''+''' 1 lanosterol[c] '''=>''' 1 H2O[c] '''+''' 1 NADP+[c] '''+''' 1 14-hydroxylanosterol[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_8263]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341] | ||
| + | ** '''8''' reactions found over '''22''' reactions in the full pathway | ||
| + | * [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4] | ||
| + | ** '''7''' reactions found over '''22''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=lanosterol 14-hydroxylase}} | |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_8263}} |
| − | {{#set: | + | {{#set: in pathway=PWY66-341|PWY66-4}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | {{#set: reconstruction source=esiliculosus}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:35, 10 January 2018
Contents
Reaction RXN66-303
- direction:
- LEFT-TO-RIGHT
- common name:
- lanosterol 14-hydroxylase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADPH[c] + 1 OXYGEN-MOLECULE[c] + 1 PROTON[c] + 1 LANOSTEROL[c] => 1 WATER[c] + 1 NADP[c] + 1 CPD-4568[c]
- With common name(s):
- 1 NADPH[c] + 1 oxygen[c] + 1 H+[c] + 1 lanosterol[c] => 1 H2O[c] + 1 NADP+[c] + 1 14-hydroxylanosterol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY66-341, cholesterol biosynthesis I: PWY66-341
- 8 reactions found over 22 reactions in the full pathway
- PWY66-4, cholesterol biosynthesis III (via desmosterol): PWY66-4
- 7 reactions found over 22 reactions in the full pathway
