Difference between revisions of "CPD-13694"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-PHENYLPROPIONATE 3-PHENYLPROPIONATE] == * smiles: ** C(CCC1(=CC=CC=C1))([O-])=O * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GUANYLCYC-RXN GUANYLCYC-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.or...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GUANYLCYC-RXN GUANYLCYC-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.6.1.2 EC-4.6.1.2] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[GTP]][c] '''<=>''' 1 [[PPI]][c] '''+''' 1 [[CGMP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 GTP[c] '''<=>''' 1 diphosphate[c] '''+''' 1 cyclic-GMP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_8950]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[Tiso_gene_11316]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_11317]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_16143]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[creinhardtii]] | ||
+ | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13665 13665] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00434 R00434] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P51840 P51840] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q24051 Q24051] |
− | * | + | ** [http://www.uniprot.org/uniprot/P51842 P51842] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P51839 P51839] |
− | * | + | ** [http://www.uniprot.org/uniprot/P51841 P51841] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O02740 O02740] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q02846 Q02846] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q07093 Q07093] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P16068 P16068] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P19687 P19687] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P16066 P16066] |
+ | ** [http://www.uniprot.org/uniprot/P20594 P20594] | ||
+ | ** [http://www.uniprot.org/uniprot/P25092 P25092] | ||
+ | ** [http://www.uniprot.org/uniprot/P18293 P18293] | ||
+ | ** [http://www.uniprot.org/uniprot/P19686 P19686] | ||
+ | ** [http://www.uniprot.org/uniprot/P20595 P20595] | ||
+ | ** [http://www.uniprot.org/uniprot/P22717 P22717] | ||
+ | ** [http://www.uniprot.org/uniprot/P16067 P16067] | ||
+ | ** [http://www.uniprot.org/uniprot/P18910 P18910] | ||
+ | ** [http://www.uniprot.org/uniprot/P16065 P16065] | ||
+ | ** [http://www.uniprot.org/uniprot/P11528 P11528] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M058 Q7M058] | ||
+ | ** [http://www.uniprot.org/uniprot/Q02153 Q02153] | ||
+ | ** [http://www.uniprot.org/uniprot/Q02108 Q02108] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9TS82 Q9TS82] | ||
+ | ** [http://www.uniprot.org/uniprot/P55203 P55203] | ||
+ | ** [http://www.uniprot.org/uniprot/Q09435 Q09435] | ||
+ | ** [http://www.uniprot.org/uniprot/P55205 P55205] | ||
+ | ** [http://www.uniprot.org/uniprot/O57480 O57480] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: ec number=EC-4.6.1.2}} | ||
+ | {{#set: gene associated=Tiso_gene_8950|Tiso_gene_11316|Tiso_gene_11317|Tiso_gene_16143}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction tool=pantograph}} | ||
+ | {{#set: reconstruction source=creinhardtii|esiliculosus}} |
Revision as of 16:35, 10 January 2018
Contents
Reaction GUANYLCYC-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 GTP[c] <=> 1 diphosphate[c] + 1 cyclic-GMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: