Difference between revisions of "Tiso gene 11351"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13204 == * Synonym(s): == Reactions associated == * TRANS-RXN0-460 ** pantograph-creinhardtii ** pantograph-creinhardtii...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == |
+ | * smiles: | ||
+ | ** [CH](=O)C(O)C(O)C(O)CO | ||
+ | * inchi key: | ||
+ | ** InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N | ||
+ | * common name: | ||
+ | ** aldehydo-L-arabinose | ||
+ | * molecular weight: | ||
+ | ** 150.131 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14102]] | |
− | + | * [[RXN-14808]] | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460291 5460291] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476] | ||
+ | {{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}} | ||
+ | {{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N}} | ||
+ | {{#set: common name=aldehydo-L-arabinose}} | ||
+ | {{#set: molecular weight=150.131 }} | ||
+ | {{#set: consumed or produced by=RXN-14102|RXN-14808}} |
Revision as of 15:39, 10 January 2018
Contents
Metabolite CPD-15699
- smiles:
- [CH](=O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
- common name:
- aldehydo-L-arabinose
- molecular weight:
- 150.131
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.