Difference between revisions of "13-HYDROXY-MAGNESIUM-PROTOPORP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_2478 == * Synonym(s): == Reactions associated == * 1.6.5.4-RXN ** pantograph-athaliana ** pantograph-athaliana == Path...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2478 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[1.6.5.4-RXN]] |
− | + | ** [[pantograph]]-[[athaliana]] | |
− | == | + | ** [[pantograph]]-[[athaliana]] |
+ | == Pathways associated == | ||
+ | * [[PWY-6370]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=1.6.5.4-RXN}} | |
− | + | {{#set: pathway associated=PWY-6370}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 17:35, 10 January 2018
Gene Tiso_gene_2478
- Synonym(s):