Difference between revisions of "RXN-12789"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SALVPURINE2-PWY SALVPURINE2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == * smiles: ** C1(NC=NC=1CC(CO)[N+]) * inchi key: ** InChIKey=ZQISRDCJN...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(NC=NC=1CC(CO)[N+]) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O |
* common name: | * common name: | ||
| − | ** | + | ** histidinol |
| + | * molecular weight: | ||
| + | ** 142.18 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** histidol | ||
| + | ** L-histidinol | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-8001]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[HISTIDPHOS-RXN]] | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | * | + | * [[HISTOLDEHYD-RXN]] |
== External links == | == External links == | ||
| − | * | + | * CAS : 501-28-0 |
| − | ** [http:// | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6950298 6950298] |
| − | {{#set: | + | * KNAPSACK : C00007479 |
| − | {{#set: | + | * HMDB : HMDB03431 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00860 C00860] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57699 57699] | ||
| + | * BIGG : histd | ||
| + | {{#set: smiles=C1(NC=NC=1CC(CO)[N+])}} | ||
| + | {{#set: inchi key=InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O}} | ||
| + | {{#set: common name=histidinol}} | ||
| + | {{#set: molecular weight=142.18 }} | ||
| + | {{#set: common name=histidol|L-histidinol}} | ||
| + | {{#set: consumed by=RXN-8001}} | ||
| + | {{#set: produced by=HISTIDPHOS-RXN}} | ||
| + | {{#set: consumed or produced by=HISTOLDEHYD-RXN}} | ||
Revision as of 16:36, 10 January 2018
Contents
Metabolite HISTIDINOL
- smiles:
- C1(NC=NC=1CC(CO)[N+])
- inchi key:
- InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
- common name:
- histidinol
- molecular weight:
- 142.18
- Synonym(s):
- histidol
- L-histidinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 501-28-0
- PUBCHEM:
- KNAPSACK : C00007479
- HMDB : HMDB03431
- LIGAND-CPD:
- CHEBI:
- BIGG : histd
"C1(NC=NC=1CC(CO)[N+])" cannot be used as a page name in this wiki.
