Difference between revisions of "CPD-1103"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-asparaginyl-Protein L-methionyl-L-asparaginyl-Protein] == * common name: ** an N-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * inchi key: ** InChIKey=WQZGKK...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == |
+ | * smiles: | ||
+ | ** C(O)C1(C(O)C(O)C(O)C(O)O1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** α-D-mannopyranose |
+ | * molecular weight: | ||
+ | ** 180.157 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3.2.1.24-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=185698 185698] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28729 28729] | ||
+ | * METABOLIGHTS : MTBLC28729 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00936 C00936] | ||
+ | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O)O1)}} | ||
+ | {{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N}} | ||
+ | {{#set: common name=α-D-mannopyranose}} | ||
+ | {{#set: molecular weight=180.157 }} | ||
+ | {{#set: produced by=3.2.1.24-RXN}} |
Revision as of 16:36, 10 January 2018
Contents
Metabolite CPD-13559
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O)O1)
- inchi key:
- InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N
- common name:
- α-D-mannopyranose
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links