Difference between revisions of "DTTUP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Apocytochromes-c Apocytochromes-c] == * common name: ** an apo-[c-type cytochrome] * Synonym(s)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Apocytochromes-c Apocytochromes-c] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] ==
 +
* smiles:
 +
** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))
 +
* inchi key:
 +
** InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M
 
* common name:
 
* common name:
** an apo-[c-type cytochrome]
+
** leucodopachrome
 +
* molecular weight:
 +
** 194.166   
 
* Synonym(s):
 
* Synonym(s):
** an apocytochrome c
+
** cyclo-dopa
 +
** 2-carboxy-2,3-dihydro-5,6-dihydroxyindole
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11369]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8483]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=an apo-[c-type cytochrome]}}
+
* PUBCHEM:
{{#set: common name=an apocytochrome c}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202233 25202233]
{{#set: consumed or produced by=HOLOCYTOCHROME-C-SYNTHASE-RXN}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05604 C05604]
 +
* HMDB : HMDB04067
 +
{{#set: smiles=C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))}}
 +
{{#set: inchi key=InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M}}
 +
{{#set: common name=leucodopachrome}}
 +
{{#set: molecular weight=194.166    }}
 +
{{#set: common name=cyclo-dopa|2-carboxy-2,3-dihydro-5,6-dihydroxyindole}}
 +
{{#set: consumed by=RXN-11369}}
 +
{{#set: produced by=RXN-8483}}

Revision as of 16:36, 10 January 2018

Metabolite CPD-8652

  • smiles:
    • C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))
  • inchi key:
    • InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M
  • common name:
    • leucodopachrome
  • molecular weight:
    • 194.166
  • Synonym(s):
    • cyclo-dopa
    • 2-carboxy-2,3-dihydro-5,6-dihydroxyindole

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))" cannot be used as a page name in this wiki.