Difference between revisions of "NUCLEOSIDE-DIPHOSPHATASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1960 == * left end position: ** 16698 * transcription direction: ** POSITIVE * right end position: ** 20506 * centisome position: ** 79.412...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == * smiles: ** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_1960 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] ==
* left end position:
+
* smiles:
** 16698
+
** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
* right end position:
+
* common name:
** 20506
+
** (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
* centisome position:
+
* molecular weight:
** 79.412186    
+
** 959.791    
 
* Synonym(s):
 
* Synonym(s):
 +
** (S)-3-hydroxy-12:1-Δ5-CoA
 +
** (S)-3-hydroxy-5-cis-dodecenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ATPASE-RXN]]
+
* [[RXN-17798]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN-17797]]
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** in-silico_annotation
+
***ec-number
+
* [[RXN-12195]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-12196]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN0-5462]]
+
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-7210]]
+
* [[PWY-7198]]
+
* [[PWY-6545]]
+
* [[PWY-7184]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=16698}}
+
{{#set: smiles=CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: transcription direction=POSITIVE}}
+
{{#set: inchi key=InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J}}
{{#set: right end position=20506}}
+
{{#set: common name=(S)-3-hydroxy-(5Z)-dodecenoyl-CoA}}
{{#set: centisome position=79.412186   }}
+
{{#set: molecular weight=959.791   }}
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
+
{{#set: common name=(S)-3-hydroxy-12:1-Δ5-CoA|(S)-3-hydroxy-5-cis-dodecenoyl-CoA}}
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-6545|PWY-7184}}
+
{{#set: consumed by=RXN-17798}}
 +
{{#set: produced by=RXN-17797}}

Revision as of 16:38, 10 January 2018

Metabolite CPD-19151

  • smiles:
    • CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
  • common name:
    • (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
  • molecular weight:
    • 959.791
  • Synonym(s):
    • (S)-3-hydroxy-12:1-Δ5-CoA
    • (S)-3-hydroxy-5-cis-dodecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.