Difference between revisions of "GAMMA-LINOLENOYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] == * smiles: ** CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O * inchi key: ** InChIK...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7761 PWY-7761] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7761 PWY-7761] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** NAD salvage pathway II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** PNC IV cycle |
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | * '''1''' reaction(s) found |
− | * [ | + | ** [[NICONUCADENYLYLTRAN-RXN]] |
− | * [ | + | == Reaction(s) not found == |
− | * [ | + | * '''3''' reaction(s) not found |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=NAD-SYNTH-GLN-RXN NAD-SYNTH-GLN-RXN] | |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=NADPYROPHOSPHAT-RXN NADPYROPHOSPHAT-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=NMNAMIDOHYDRO-RXN NMNAMIDOHYDRO-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7761 PWY-7761] |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=NAD salvage pathway II}} | |
− | + | {{#set: common name=PNC IV cycle}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=3}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:39, 10 January 2018
Pathway PWY-7761
- taxonomic range:
- common name:
- NAD salvage pathway II
- Synonym(s):
- PNC IV cycle
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 3 reaction(s) not found
External links
- ECOCYC: