Difference between revisions of "D-RIBULOSE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_253 == * Synonym(s): == Reactions associated == * ATPASE-RXN ** in-silico_annotation ***ec-number == Pathways associated == == Externa...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] == * smiles: ** CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O * inchi key: ** InChIK...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] == |
+ | * smiles: | ||
+ | ** CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N | ||
+ | * common name: | ||
+ | ** 2-cis,4-trans-xanthoxin | ||
+ | * molecular weight: | ||
+ | ** 250.337 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** xanthoxin | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RXN-7973]] |
− | * | + | * [[RXN-7974]] |
− | == | + | * [[RXN-698]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820570 91820570] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4445403.html 4445403] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32304 32304] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C13453 C13453] | ||
+ | {{#set: smiles=CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O}} | ||
+ | {{#set: inchi key=InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N}} | ||
+ | {{#set: common name=2-cis,4-trans-xanthoxin}} | ||
+ | {{#set: molecular weight=250.337 }} | ||
+ | {{#set: common name=xanthoxin}} | ||
+ | {{#set: produced by=RXN-7973|RXN-7974|RXN-698}} |
Revision as of 16:41, 10 January 2018
Contents
Metabolite CPD-7279
- smiles:
- CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O
- inchi key:
- InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N
- common name:
- 2-cis,4-trans-xanthoxin
- molecular weight:
- 250.337
- Synonym(s):
- xanthoxin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links