Difference between revisions of "Tiso gene 3374"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7526 CPD-7526] == * smiles: ** CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * smiles: ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) * inchi key: ** InChIKey=MY...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == |
* smiles: | * smiles: | ||
− | ** | + | ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** 7,8-dihydrolumazine |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 166.139 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-15261]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=590555 590555] |
− | + | {{#set: smiles=C2(=O)(C1(=C(NCC=N1)NC(=O)N2))}} | |
− | + | {{#set: inchi key=InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N}} | |
− | + | {{#set: common name=7,8-dihydrolumazine}} | |
− | + | {{#set: molecular weight=166.139 }} | |
− | + | {{#set: produced by=RXN-15261}} | |
− | + | ||
− | + | ||
− | {{#set: smiles= | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:41, 10 January 2018
Contents
Metabolite CPD-16458
- smiles:
- C2(=O)(C1(=C(NCC=N1)NC(=O)N2))
- inchi key:
- InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N
- common name:
- 7,8-dihydrolumazine
- molecular weight:
- 166.139
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: