Difference between revisions of "PWY-5298"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-717 RXN-717] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With iden...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-717 RXN-717] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[Acceptor]][c] '''+''' 1 [[CPD-716]][c] '''=>''' 1 [[CPD-718]][c] '''+''' 1 [[Donor-H2]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 an oxidized electron acceptor[c] '''+''' 1 teasterone[c] '''=>''' 1 3-dehydroteasterone[c] '''+''' 1 a reduced electron acceptor[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_3577]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | * [[Tiso_gene_8263]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-699]], brassinosteroid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-699 PWY-699] | ||
| + | ** '''11''' reactions found over '''25''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-RXN: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07444 R07444] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | ** [http://www. | + | {{#set: gene associated=Tiso_gene_3577|Tiso_gene_8263}} |
| − | + | {{#set: in pathway=PWY-699}} | |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | {{#set: reconstruction source=esiliculosus}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:42, 10 January 2018
Contents
Reaction RXN-717
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 an oxidized electron acceptor[c] + 1 teasterone[c] => 1 3-dehydroteasterone[c] + 1 a reduced electron acceptor[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-699, brassinosteroid biosynthesis I: PWY-699
- 11 reactions found over 25 reactions in the full pathway
Reconstruction information
External links
- LIGAND-RXN:
