Difference between revisions of "Tiso gene 1602"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4288 == * left end position: ** 77 * transcription direction: ** POSITIVE * right end position: ** 3158 * centisome position: ** 0.5107455...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == |
| − | * | + | * smiles: |
| − | ** | + | ** [CH](=O)C(C(C(C(CO)O)O)O)O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N |
| − | * | + | * common name: |
| − | ** | + | ** aldehydo-D-galactose |
| − | * | + | * molecular weight: |
| − | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14409]] | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01582 C01582] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17118 17118] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3037556 3037556] |
| + | {{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}} | ||
| + | {{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N}} | ||
| + | {{#set: common name=aldehydo-D-galactose}} | ||
| + | {{#set: molecular weight=180.157 }} | ||
| + | {{#set: consumed or produced by=RXN-14409}} | ||
Revision as of 16:44, 10 January 2018
Contents
Metabolite CPD-15590
- smiles:
- [CH](=O)C(C(C(C(CO)O)O)O)O
- inchi key:
- InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N
- common name:
- aldehydo-D-galactose
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(C(C(C(CO)O)O)O)O" cannot be used as a page name in this wiki.
