Difference between revisions of "RNASE-III-MRNA-PROCESSING-SUBSTRATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] == * smiles: ** COC1(C(O)C(O)C(O)C(O)C(O)1) * inch...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Saturated-Fatty-Acyl-ACPs Saturated-Fatty-Acyl-ACPs] == * common name: ** a 2,3,4-saturated fat...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-MYO-INOSITOL 4-METHYL-MYO-INOSITOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Saturated-Fatty-Acyl-ACPs Saturated-Fatty-Acyl-ACPs] ==
−
* smiles:
+
−
** COC1(C(O)C(O)C(O)C(O)C(O)1)
+
−
* inchi key:
+
−
** InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N
+
 
* common name:
 
* common name:
−
** D-ononitol
+
** a 2,3,4-saturated fatty acyl-[acp]
−
* molecular weight:
+
−
** 194.184   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-O-methyl-myo-inositol
 
−
** ononitol
 
−
** 1D-4-O-methyl-myo-inositol
 
−
** 4-methyl-myo-inositol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-8281]]
+
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[RXN0-5514]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ENOYL-ACP-REDUCT-NADPH-RXN]]
 +
* [[ENOYL-ACP-REDUCT-NADH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a 2,3,4-saturated fatty acyl-[acp]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06352 C06352]
+
{{#set: consumed by=3-OXOACYL-ACP-SYNTH-RXN|RXN0-5514}}
−
* CHEBI:
+
{{#set: produced by=ENOYL-ACP-REDUCT-NADPH-RXN|ENOYL-ACP-REDUCT-NADH-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18266 18266]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12300199 12300199]
+
−
* HMDB : HMDB29915
+
−
{{#set: smiles=COC1(C(O)C(O)C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=DSCFFEYYQKSRSV-GESKJZQWSA-N}}
+
−
{{#set: common name=D-ononitol}}
+
−
{{#set: molecular weight=194.184    }}
+
−
{{#set: common name=4-O-methyl-myo-inositol|ononitol|1D-4-O-methyl-myo-inositol|4-methyl-myo-inositol}}
+
−
{{#set: consumed by=RXN-8281}}
+

Revision as of 16:46, 10 January 2018

Metabolite Saturated-Fatty-Acyl-ACPs

  • common name:
    • a 2,3,4-saturated fatty acyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 2,3,4-saturated fatty acyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RNASE-III-MRNA-PROCESSING-SUBSTRATE&oldid=14519"