Difference between revisions of "Tiso gene 18943"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...") |
(Created page with "Category:Gene == Gene Tiso_gene_92 == * left end position: ** 20519 * transcription direction: ** POSITIVE * right end position: ** 22089 * centisome position: ** 45.38698...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_92 == |
− | * | + | * left end position: |
− | ** | + | ** 20519 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 22089 |
− | * | + | * centisome position: |
− | ** | + | ** 45.38698 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[DIHYDROFOLATESYNTH-RXN]] |
− | + | ** [[pantograph]]-[[synechocystis]] | |
− | * [[RXN- | + | * [[FOLYLPOLYGLUTAMATESYNTH-RXN]] |
− | == | + | ** in-silico_annotation |
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[FORMYLTHFGLUSYNTH-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-6341]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN0-2921]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-2161]] | ||
+ | * [[PWY-6614]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=20519}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: right end position=22089}} |
− | {{#set: | + | {{#set: centisome position=45.38698 }} |
− | {{#set: | + | {{#set: reaction associated=DIHYDROFOLATESYNTH-RXN|FOLYLPOLYGLUTAMATESYNTH-RXN|FORMYLTHFGLUSYNTH-RXN|RXN-6341|RXN0-2921}} |
− | {{#set: | + | {{#set: pathway associated=PWY-2161|PWY-6614}} |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 17:46, 10 January 2018
Gene Tiso_gene_92
- left end position:
- 20519
- transcription direction:
- POSITIVE
- right end position:
- 22089
- centisome position:
- 45.38698
- Synonym(s):
Reactions associated
- DIHYDROFOLATESYNTH-RXN
- FOLYLPOLYGLUTAMATESYNTH-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- FORMYLTHFGLUSYNTH-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-6341
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN0-2921
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation