Difference between revisions of "RXN-14208"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * smiles: ** C1(C=C(O)C=CC=1C3(=CC(=O)C2(=C(C=C([O-])C=C(O)2)O3))) * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_11164 == * left end position: ** 2174 * transcription direction: ** POSITIVE * right end position: ** 3854 * centisome position: ** 27.2328...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11164 == |
− | * | + | * left end position: |
− | ** | + | ** 2174 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3854 |
− | * | + | * centisome position: |
− | ** | + | ** 27.23287 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[OROPRIBTRANS-RXN]] |
− | + | ** in-silico_annotation | |
− | == | + | ***ec-number |
+ | == Pathways associated == | ||
+ | * [[PWY-7790]] | ||
+ | * [[PWY-7791]] | ||
+ | * [[PWY-5686]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2174}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3854}} | |
− | + | {{#set: centisome position=27.23287 }} | |
− | + | {{#set: reaction associated=OROPRIBTRANS-RXN}} | |
− | + | {{#set: pathway associated=PWY-7790|PWY-7791|PWY-5686}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:46, 10 January 2018
Gene Tiso_gene_11164
- left end position:
- 2174
- transcription direction:
- POSITIVE
- right end position:
- 3854
- centisome position:
- 27.23287
- Synonym(s):
Reactions associated
- OROPRIBTRANS-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation