Difference between revisions of "Tiso gene 6151"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * smiles: ** C(CC1(C=C(C(=CC=1)O)O))[N+] * inchi key: ** InChIKey=VYFYYTL...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-167 RXN1F-167] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-167 RXN1F-167] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-695]][c] '''=>''' 1 [[SUC]][c] '''+''' 1 [[CPD-10332]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 2-oxoglutarate[c] '''+''' 1 oxygen[c] '''+''' 1 gibberellin A53[c] '''=>''' 1 succinate[c] '''+''' 1 gibberellin44 (open lactone form)[c] '''+''' 1 CO2[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_3330]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5035]], gibberellin biosynthesis III (early C-13 hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5035 PWY-5035] | ||
+ | ** '''3''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[athaliana]] | ||
+ | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05097 R05097] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.14.11}} | |
− | + | {{#set: gene associated=Tiso_gene_3330}} | |
− | * LIGAND- | + | {{#set: in pathway=PWY-5035}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | {{#set: reconstruction source=athaliana|esiliculosus}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:40, 10 January 2018
Contents
Reaction RXN1F-167
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-KETOGLUTARATE[c] + 1 OXYGEN-MOLECULE[c] + 1 CPD-695[c] => 1 SUC[c] + 1 CPD-10332[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 2-oxoglutarate[c] + 1 oxygen[c] + 1 gibberellin A53[c] => 1 succinate[c] + 1 gibberellin44 (open lactone form)[c] + 1 CO2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-5035, gibberellin biosynthesis III (early C-13 hydroxylation): PWY-5035
- 3 reactions found over 7 reactions in the full pathway
Reconstruction information
External links
- LIGAND-RXN: