Difference between revisions of "Tiso gene 14419"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16496 == * Synonym(s): == Reactions associated == * 3.4.25.1-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPATE TROPATE] == * smiles: ** C(O)C(C1(C=CC=CC=1))C([O-])=O * inchi key: ** InChIKey=JACRWUW...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPATE TROPATE] == |
+ | * smiles: | ||
+ | ** C(O)C(C1(C=CC=CC=1))C([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=JACRWUWPXAESPB-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** tropate | ||
+ | * molecular weight: | ||
+ | ** 165.168 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[TROPINESTERASE-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * NCI: |
+ | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=20990 20990] | ||
+ | * CAS : 529-64-6 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460086 5460086] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01456 C01456] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573754.html 4573754] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17000 17000] | ||
+ | {{#set: smiles=C(O)C(C1(C=CC=CC=1))C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=JACRWUWPXAESPB-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=tropate}} | ||
+ | {{#set: molecular weight=165.168 }} | ||
+ | {{#set: produced by=TROPINESTERASE-RXN}} |
Revision as of 16:47, 10 January 2018
Contents
Metabolite TROPATE
- smiles:
- C(O)C(C1(C=CC=CC=1))C([O-])=O
- inchi key:
- InChIKey=JACRWUWPXAESPB-UHFFFAOYSA-M
- common name:
- tropate
- molecular weight:
- 165.168
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(C1(C=CC=CC=1))C([O-])=O" cannot be used as a page name in this wiki.