Difference between revisions of "3-Hydroxy-octanoyl-ACPs"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-240 RXN1G-240] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta9-3-oxo-C28:1-[acy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C * inchi key: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C |
+ | * inchi key: | ||
+ | ** InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 2-methyl-6-phytyl-1,4-benzoquinol |
− | * | + | * molecular weight: |
− | ** | + | ** 402.659 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-2542]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-2541]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15882 C15882] | |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75920 75920] | |
− | + | * METABOLIGHTS : MTBLC75920 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768135 71768135] |
− | {{#set: | + | * HMDB : HMDB38959 |
− | {{#set: | + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N}} |
− | {{#set: | + | {{#set: common name=2-methyl-6-phytyl-1,4-benzoquinol}} |
+ | {{#set: molecular weight=402.659 }} | ||
+ | {{#set: consumed by=RXN-2542}} | ||
+ | {{#set: produced by=RXN-2541}} |
Revision as of 17:47, 10 January 2018
Contents
Metabolite MPBQ
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C
- inchi key:
- InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N
- common name:
- 2-methyl-6-phytyl-1,4-benzoquinol
- molecular weight:
- 402.659
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links