Difference between revisions of "CPD0-1133"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15368 CPD-15368] == * smiles: ** CCCCCCC(O)CC=CCCCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE L-RIBULOSE] == * smiles: ** C(O)C(O)C(O)C(=O)CO * inchi key: ** InChIKey=ZAQJHHRNXZU...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE L-RIBULOSE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C(O)C(O)C(=O)CO |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ZAQJHHRNXZUBTE-UCORVYFPSA-N |
* common name: | * common name: | ||
| − | ** | + | ** L-ribulose |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 150.131 |
* Synonym(s): | * Synonym(s): | ||
| + | ** ribulose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-5116]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 488-84-6 | ||
| + | * CAS : 2042-27-5 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644111 644111] |
| − | {{#set: smiles= | + | * HMDB : HMDB03371 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00508 C00508] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: consumed by= | + | ** [http://www.chemspider.com/Chemical-Structure.559151.html 559151] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16880 16880] | ||
| + | * BIGG : rbl__L | ||
| + | {{#set: smiles=C(O)C(O)C(O)C(=O)CO}} | ||
| + | {{#set: inchi key=InChIKey=ZAQJHHRNXZUBTE-UCORVYFPSA-N}} | ||
| + | {{#set: common name=L-ribulose}} | ||
| + | {{#set: molecular weight=150.131 }} | ||
| + | {{#set: common name=ribulose}} | ||
| + | {{#set: consumed by=RXN0-5116}} | ||
Revision as of 16:48, 10 January 2018
Contents
Metabolite L-RIBULOSE
- smiles:
- C(O)C(O)C(O)C(=O)CO
- inchi key:
- InChIKey=ZAQJHHRNXZUBTE-UCORVYFPSA-N
- common name:
- L-ribulose
- molecular weight:
- 150.131
- Synonym(s):
- ribulose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 488-84-6
- CAS : 2042-27-5
- PUBCHEM:
- HMDB : HMDB03371
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : rbl__L
