Difference between revisions of "RXN-5468"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == * smiles: ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5532 PWY-5532] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5532 PWY-5532] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** nucleoside and nucleotide degradation (archaea) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | * '''3''' reaction(s) found |
− | + | ** [[URPHOS-RXN]] | |
− | * [[RXN- | + | ** [[CYTIKIN-RXN]] |
+ | ** [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''7''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=ADENPHOSPHOR-RXN ADENPHOSPHOR-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-14699 RXN-14699] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-14700 RXN-14700] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5199 RXN0-5199] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17337 RXN-17337] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8801 RXN-8801] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8800 RXN-8800] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: common name=nucleoside and nucleotide degradation (archaea)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: reaction not found=7}} | |
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 15:41, 10 January 2018
Pathway PWY-5532
- taxonomic range:
- common name:
- nucleoside and nucleotide degradation (archaea)
- Synonym(s):
Reaction(s) found
- 3 reaction(s) found