Difference between revisions of "RXN-11195"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-420 CPD-420] == * smiles: ** CC(NC(C(=O)[O-])CC(=O)[O-])=O * inchi key: ** InChIKey=OTCCIMW...") |
(Created page with "Category:Gene == Gene Tiso_gene_6675 == * left end position: ** 6956 * transcription direction: ** POSITIVE * right end position: ** 8416 * centisome position: ** 58.2482...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6675 == |
− | * | + | * left end position: |
− | ** | + | ** 6956 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 8416 |
− | * | + | * centisome position: |
− | ** | + | ** 58.2482 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[1.1.1.39-RXN]] | |
− | == | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[MALIC-NADP-RXN]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-3641]] | ||
+ | * [[GLUCONEO-PWY]] | ||
+ | * [[PWY-7384]] | ||
+ | * [[PWY-7686]] | ||
+ | * [[PWY-7117]] | ||
+ | * [[PWY-7115]] | ||
+ | * [[PWY-7118]] | ||
+ | * [[PWY-241]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6956}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=8416}} | |
− | + | {{#set: centisome position=58.2482 }} | |
− | + | {{#set: reaction associated=1.1.1.39-RXN|MALIC-NADP-RXN}} | |
− | + | {{#set: pathway associated=PWY-3641|GLUCONEO-PWY|PWY-7384|PWY-7686|PWY-7117|PWY-7115|PWY-7118|PWY-241}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:49, 10 January 2018
Gene Tiso_gene_6675
- left end position:
- 6956
- transcription direction:
- POSITIVE
- right end position:
- 8416
- centisome position:
- 58.2482
- Synonym(s):
Reactions associated
- 1.1.1.39-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- MALIC-NADP-RXN