|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.34-RXN 1.1.1.34-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34)))) |
| + | * inchi key: |
| + | ** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M |
| * common name: | | * common name: |
− | ** ORF | + | ** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol |
− | ** mitochondrial_carrier_protein | + | * molecular weight: |
− | * ec number:
| + | ** 427.646 |
− | ** [http://enzyme.expasy.org/EC/1.1.1.34 EC-1.1.1.34] | + | |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN66-318]] |
− | ** 2 [[NADP]][c] '''+''' 1 [[MEVALONATE]][c] '''+''' 1 [[CO-A]][c] '''<=>''' 1 [[3-HYDROXY-3-METHYL-GLUTARYL-COA]][c] '''+''' 2 [[NADPH]][c] '''+''' 2 [[PROTON]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 2 NADP+[c] '''+''' 1 (R)-mevalonate[c] '''+''' 1 coenzyme A[c] '''<=>''' 1 (S)-3-hydroxy-3-methylglutaryl-CoA[c] '''+''' 2 NADPH[c] '''+''' 2 H+[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_16182]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_17889]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | * [[PWY-922]], mevalonate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922]
| + | |
− | ** '''6''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-6174]], mevalonate pathway II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174]
| + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-7391]], isoprene biosynthesis II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7391 PWY-7391]
| + | |
− | ** '''6''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-7524]], mevalonate pathway III (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7524 PWY-7524]
| + | |
− | ** '''4''' reactions found over '''8''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15989 15989] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076] |
− | * LIGAND-RXN:
| + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R02082 R02082]
| + | {{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}} |
− | * UNIPROT:
| + | {{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}} |
− | ** [http://www.uniprot.org/uniprot/P16393 P16393]
| + | {{#set: molecular weight=427.646 }} |
− | ** [http://www.uniprot.org/uniprot/P14891 P14891]
| + | {{#set: consumed by=RXN66-318}} |
− | ** [http://www.uniprot.org/uniprot/P16237 P16237]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20715 P20715]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59468 Q59468]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01237 Q01237]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q61671 Q61671]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q944T9 Q944T9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S9C2 Q9S9C2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S999 Q9S999]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S998 Q9S998]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S997 Q9S997]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04035 P04035]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00347 P00347]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29058 P29058]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29057 P29057]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12577 Q12577]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12649 Q12649]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00583 Q00583]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01559 Q01559]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48022 P48022]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43825 Q43825]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43826 Q43826]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14773 P14773]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4W2 Q7M4W2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4W1 Q7M4W1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4W4 Q7M4W4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4W3 Q7M4W3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48019 P48019]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41454 Q41454]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42506 Q42506]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41455 Q41455]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41456 Q41456]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41458 Q41458]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48020 P48020]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9FS01 Q9FS01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42466 Q42466]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48624 O48624]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04188 O04188]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24594 O24594]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41438 Q41438]
| + | |
− | ** [http://www.uniprot.org/uniprot/O64966 O64966]
| + | |
− | ** [http://www.uniprot.org/uniprot/O64967 O64967]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03163 Q03163]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39628 Q39628]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93514 P93514]
| + | |
− | ** [http://www.uniprot.org/uniprot/O08424 O08424]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=ORF}}
| + | |
− | {{#set: common name=mitochondrial_carrier_protein}} | + | |
− | {{#set: ec number=EC-1.1.1.34}}
| + | |
− | {{#set: gene associated=Tiso_gene_16182|Tiso_gene_17889}} | + | |
− | {{#set: in pathway=PWY-922|PWY-6174|PWY-7391|PWY-7524}}
| + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=in-silico_annotation}} | + | |