Difference between revisions of "L-GLYCERALDEHYDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6656 TA...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6656 TAX-6656]
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
 
* common name:
 
* common name:
** trehalose biosynthesis I
+
** ergosta-5,7,24(28)-trien-3β-ol
 +
* molecular weight:
 +
** 396.655   
 
* Synonym(s):
 
* Synonym(s):
** trehalose biosynthesis
+
** 5,7,24(28)-ergostatrienol
 +
** 5-dehydro episterol
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''2''' reaction(s) found
+
* [[RXN-707]]
** [[TREHALOSEPHOSPHA-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[TREHALOSE6PSYN-RXN]]
+
* [[RXN3O-218]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
* ECOCYC:
+
* LIGAND-CPD:
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY]
+
** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780]
{{#set: taxonomic range=TAX-6656}}
+
* HMDB : HMDB06848
{{#set: taxonomic range=TAX-2}}
+
* CHEBI:
{{#set: taxonomic range=TAX-4751}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972]
{{#set: common name=trehalose biosynthesis I}}
+
* PUBCHEM:
{{#set: common name=trehalose biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570]
{{#set: reaction found=2}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
{{#set: reaction not found=0}}
+
{{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}}
 +
{{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}}
 +
{{#set: molecular weight=396.655    }}
 +
{{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}}
 +
{{#set: consumed by=RXN-707}}
 +
{{#set: produced by=RXN3O-218}}

Revision as of 16:41, 10 January 2018

Metabolite CPD-700

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
  • common name:
    • ergosta-5,7,24(28)-trien-3β-ol
  • molecular weight:
    • 396.655
  • Synonym(s):
    • 5,7,24(28)-ergostatrienol
    • 5-dehydro episterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.