Difference between revisions of "RXN-10039"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-1346 CPD1G-1346] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCCCCCCC(C(OCC1(OC(C(C(C1O)O)O)OC2(C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N |
* common name: | * common name: | ||
| − | ** | + | ** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 414.713 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-14]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12070223 12070223] |
| − | {{#set: smiles= | + | * CHEMSPIDER: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.chemspider.com/Chemical-Structure.10474091.html 10474091] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: molecular weight= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915] |
| − | {{#set: produced by= | + | * HMDB : HMDB06840 |
| + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}} | ||
| + | {{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}} | ||
| + | {{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}} | ||
| + | {{#set: molecular weight=414.713 }} | ||
| + | {{#set: produced by=RXN66-14}} | ||
Revision as of 16:50, 10 January 2018
Contents
Metabolite CPD-8610
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
- inchi key:
- InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
- common name:
- 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
- molecular weight:
- 414.713
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
