|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=IMP-DEHYDROG-RXN IMP-DEHYDROG-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9924 CPD-9924] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-]) |
| + | * inchi key: |
| + | ** InChIKey=JKJGLRGLOMRXFN-MVWJERBFSA-K |
| * common name: | | * common name: |
− | ** inosine-5_-monophosphate_dehydrogenase | + | ** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/1.1.1.205 EC-1.1.1.205] | + | ** 325.251 |
| * Synonym(s): | | * Synonym(s): |
| + | ** SEPHCHC |
| + | ** 5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-9310]] |
− | ** 1 [[NAD]][c] '''+''' 1 [[IMP]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[XANTHOSINE-5-PHOSPHATE]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[2.5.1.64-RXN]] |
− | ** 1 NAD+[c] '''+''' 1 IMP[c] '''+''' 1 H2O[c] '''<=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 XMP[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_6377]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-7221]], guanosine ribonucleotides de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7221 PWY-7221] | + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-5695]], urate biosynthesis/inosine 5'-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5695 PWY-5695]
| + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596]
| + | |
− | ** '''8''' reactions found over '''8''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[creinhardtii]]
| + | |
− | *** [[synechocystis]]
| + | |
− | *** [[athaliana]]
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11708 11708] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657446 90657446] |
− | * LIGAND-RXN: | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01130 R01130] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50271 50271] |
− | * UNIPROT:
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P12268 P12268]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C16519 C16519] |
− | ** [http://www.uniprot.org/uniprot/P21620 P21620]
| + | {{#set: smiles=C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-])}} |
− | ** [http://www.uniprot.org/uniprot/P50098 P50098] | + | {{#set: inchi key=InChIKey=JKJGLRGLOMRXFN-MVWJERBFSA-K}} |
− | ** [http://www.uniprot.org/uniprot/P50097 P50097] | + | {{#set: common name=2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate}} |
− | ** [http://www.uniprot.org/uniprot/O26245 O26245]
| + | {{#set: molecular weight=325.251 }} |
− | ** [http://www.uniprot.org/uniprot/Q9PAR5 Q9PAR5]
| + | {{#set: common name=SEPHCHC|5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylate}} |
− | ** [http://www.uniprot.org/uniprot/P65172 P65172]
| + | {{#set: consumed by=RXN-9310}} |
− | ** [http://www.uniprot.org/uniprot/Q9X168 Q9X168]
| + | {{#set: produced by=2.5.1.64-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q9KTW3 Q9KTW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YBU2 Q9YBU2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CIY6 Q9CIY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21879 P21879]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0ADG7 P0ADG7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56088 P56088]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49058 P49058]
| + | |
− | ** [http://www.uniprot.org/uniprot/O58045 O58045]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UY49 Q9UY49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PKM2 Q9PKM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RT87 Q9RT87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JUD0 Q9JUD0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59011 Q59011]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PNN3 Q9PNN3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P44334 P44334]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67820 O67820]
| + | |
− | ** [http://www.uniprot.org/uniprot/P65167 P65167]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZL14 Q9ZL14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JZB5 Q9JZB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9HXM5 Q9HXM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0C0H6 P0C0H6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42851 P42851]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47996 P47996]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RHG9 Q9RHG9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24547 P24547]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RHG1 Q9RHG1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31002 P31002]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07152 Q07152]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38697 P38697]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50094 P50094]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39567 P39567]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50095 P50095]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49729 Q49729]
| + | |
− | ** [http://www.uniprot.org/uniprot/O14344 O14344]
| + | |
− | ** [http://www.uniprot.org/uniprot/O32912 O32912]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=inosine-5_-monophosphate_dehydrogenase}}
| + | |
− | {{#set: ec number=EC-1.1.1.205}}
| + | |
− | {{#set: gene associated=Tiso_gene_6377}} | + | |
− | {{#set: in pathway=PWY-7221|PWY-5695|PWY-6596}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=creinhardtii|synechocystis|athaliana|esiliculosus}}
| + | |
− | {{#set: reconstruction category=manual}} | + | |
− | {{#set: reconstruction source=primary_network}} | + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |