|
|
| Line 1: |
Line 1: |
| − | [[Category:Reaction]] | + | [[Category:Metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-MALTOSE ALPHA-MALTOSE] == |
| − | * direction: | + | * smiles: |
| − | ** LEFT-TO-RIGHT | + | ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O |
| − | * ec number: | + | * inchi key: |
| − | ** [http://enzyme.expasy.org/EC/3.6.1 EC-3.6.1] | + | ** InChIKey=GUBGYTABKSRVRQ-ASMJPISFSA-N |
| | + | * common name: |
| | + | ** α-maltose |
| | + | * molecular weight: |
| | + | ** 342.299 |
| | * Synonym(s): | | * Synonym(s): |
| | | | |
| − | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
| − | * With identifiers:
| + | * [[RXN-2141]] |
| − | ** 1 [[DIHYDRONEOPTERIN-P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[DIHYDRO-NEO-PTERIN]][c]
| + | == Reaction(s) known to produce the compound == |
| − | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
| − | ** 1 7,8-dihydroneopterin 3'-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 7,8-dihydroneopterin[c]
| + | |
| − | | + | |
| − | == Genes associated with this reaction == | + | |
| − | Genes have been associated with this reaction based on different elements listed below.
| + | |
| − | * [[Tiso_gene_6277]] | + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_13604]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_2924]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_17467]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | * [[Tiso_gene_8599]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_4112]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_3667]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_43]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_12636]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_5713]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_10760]]
| + | |
| − | ** [[pantograph]]-[[synechocystis]]
| + | |
| − | * [[Tiso_gene_7067]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_1142]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_277]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_17804]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_2747]]
| + | |
| − | ** [[pantograph]]-[[synechocystis]]
| + | |
| − | * [[Tiso_gene_2019]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_10158]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | * [[Tiso_gene_16712]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_14428]]
| + | |
| − | ** [[pantograph]]-[[synechocystis]]
| + | |
| − | * [[Tiso_gene_8601]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_6144]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | * [[Tiso_gene_11387]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | * [[Tiso_gene_19075]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_6767]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_13784]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_10288]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_1799]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_12514]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_15988]]
| + | |
| − | ** [[pantograph]]-[[synechocystis]]
| + | |
| − | * [[Tiso_gene_18343]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_13729]]
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | * [[Tiso_gene_15582]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_3314]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_4645]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_13847]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_8600]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_16176]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | == Pathways == | + | |
| − | * [[PWY-7539]], 6-hydroxymethyl-dihydropterin diphosphate biosynthesis III (Chlamydia): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7539 PWY-7539]
| + | |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| + | |
| − | * [[PWY-6797]], 6-hydroxymethyl-dihydropterin diphosphate biosynthesis II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6797 PWY-6797]
| + | |
| − | ** '''3''' reactions found over '''7''' reactions in the full pathway
| + | |
| − | * [[PWY-6147]], 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6147 PWY-6147]
| + | |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
| − | == Reconstruction information == | + | |
| − | * [[orthology]]:
| + | |
| − | ** [[pantograph]]:
| + | |
| − | *** [[synechocystis]]
| + | |
| − | *** [[athaliana]]
| + | |
| − | *** [[esiliculosus]]
| + | |
| | == External links == | | == External links == |
| − | * RHEA: | + | * PUBCHEM: |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25306 25306] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439341 439341] |
| − | * LIGAND-RXN: | + | * HMDB : HMDB00163 |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R04621 R04621] | + | * LIGAND-CPD: |
| − | {{#set: direction=LEFT-TO-RIGHT}}
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00897 C00897] |
| − | {{#set: ec number=EC-3.6.1}}
| + | * CHEMSPIDER: |
| − | {{#set: gene associated=Tiso_gene_6277|Tiso_gene_13604|Tiso_gene_2924|Tiso_gene_17467|Tiso_gene_8599|Tiso_gene_4112|Tiso_gene_3667|Tiso_gene_43|Tiso_gene_12636|Tiso_gene_5713|Tiso_gene_10760|Tiso_gene_7067|Tiso_gene_1142|Tiso_gene_277|Tiso_gene_17804|Tiso_gene_2747|Tiso_gene_2019|Tiso_gene_10158|Tiso_gene_16712|Tiso_gene_14428|Tiso_gene_8601|Tiso_gene_6144|Tiso_gene_11387|Tiso_gene_19075|Tiso_gene_6767|Tiso_gene_13784|Tiso_gene_10288|Tiso_gene_1799|Tiso_gene_12514|Tiso_gene_15988|Tiso_gene_18343|Tiso_gene_13729|Tiso_gene_15582|Tiso_gene_3314|Tiso_gene_4645|Tiso_gene_13847|Tiso_gene_8600|Tiso_gene_16176}} | + | ** [http://www.chemspider.com/Chemical-Structure.388469.html 388469] |
| − | {{#set: in pathway=PWY-7539|PWY-6797|PWY-6147}} | + | * CHEBI: |
| − | {{#set: reconstruction category=orthology}} | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18167 18167] |
| − | {{#set: reconstruction tool=pantograph}} | + | * METABOLIGHTS : MTBLC18167 |
| − | {{#set: reconstruction source=synechocystis|athaliana|esiliculosus}} | + | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O}} |
| | + | {{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-ASMJPISFSA-N}} |
| | + | {{#set: common name=α-maltose}} |
| | + | {{#set: molecular weight=342.299 }} |
| | + | {{#set: consumed by=RXN-2141}} |
