Difference between revisions of "Pectin"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTNH DTNH] == * direction: ** LEFT-TO-RIGHT * common name: ** dTTP nucleotidohydrolase * Synonym(s)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTNH DTNH] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dTTP nucleotidohydrolase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[1. | + | * With identifiers: |
| − | == | + | ** 1.0 [[TTP]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[CYTIDINE]][c] '''+''' 1.0 [[Pi]][c] |
| − | == | + | * With common name(s): |
| + | ** 1.0 dTTP[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 H+[c] '''+''' 1.0 cytidine[c] '''+''' 1.0 phosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_12899]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[creinhardtii]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=dTTP nucleotidohydrolase}} | |
| − | + | {{#set: gene associated=Tiso_gene_12899}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=creinhardtii}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:52, 10 January 2018
Contents
Reaction DTNH
- direction:
- LEFT-TO-RIGHT
- common name:
- dTTP nucleotidohydrolase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 dTTP[c] + 1.0 H2O[c] => 1.0 H+[c] + 1.0 cytidine[c] + 1.0 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
