Difference between revisions of "Tiso gene 10528"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * smiles: ** CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * inchi key...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == |
* smiles: | * smiles: | ||
| − | ** CC(C)= | + | ** CC(C)=CCSCC([N+])C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N |
* common name: | * common name: | ||
| − | ** | + | ** S-prenyl-L-cysteine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 189.272 |
* Synonym(s): | * Synonym(s): | ||
| − | + | ** prenyl-L-cysteine | |
| − | ** prenyl- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.8.3.5-RXN]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200435 25200435] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47914 47914] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=CC(C)= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06751 C06751] |
| − | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB12286 |
| − | {{#set: common name= | + | {{#set: smiles=CC(C)=CCSCC([N+])C(=O)[O-]}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=S-prenyl-L-cysteine}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=189.272 }} |
| − | + | {{#set: common name=prenyl-L-cysteine}} | |
| − | + | {{#set: consumed by=1.8.3.5-RXN}} | |
Revision as of 16:52, 10 January 2018
Contents
Metabolite S-PRENYL-L-CYSTEINE
- smiles:
- CC(C)=CCSCC([N+])C(=O)[O-]
- inchi key:
- InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
- common name:
- S-prenyl-L-cysteine
- molecular weight:
- 189.272
- Synonym(s):
- prenyl-L-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCSCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.
