Difference between revisions of "DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_19998 == * left end position: ** 537 * transcription direction: ** POSITIVE * right end position: ** 1547 * centisome position: ** 28.83995...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] ==
+
== Gene Tiso_gene_19998 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** 537
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
+
** 1547
−
* molecular weight:
+
* centisome position:
−
** 396.655    
+
** 28.839958    
 
* Synonym(s):
 
* Synonym(s):
−
** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[RXN-11881]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=537}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514956 102514956]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: right end position=1547}}
−
{{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}}
+
{{#set: centisome position=28.839958   }}
−
{{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: molecular weight=396.655   }}
+
−
{{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}}
+
−
{{#set: produced by=RXN-11881}}
+

Revision as of 16:52, 10 January 2018

Gene Tiso_gene_19998

  • left end position:
    • 537
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1547
  • centisome position:
    • 28.839958
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN&oldid=15068"