Difference between revisions of "Tiso gene 19107"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Gene == Gene Tiso_gene_18609 == * Synonym(s): == Reactions associated == * ALANINE--TRNA-LIGASE-RXN ** in-silico_annotation ***ec-number == Pathways associat...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_18609 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[ALANINE--TRNA-LIGASE-RXN]] | |
| − | * [[ | + | ** in-silico_annotation |
| − | == | + | ***ec-number |
| − | * [[ | + | == Pathways associated == |
| + | * [[TRNA-CHARGING-PWY]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=ALANINE--TRNA-LIGASE-RXN}} | |
| − | + | {{#set: pathway associated=TRNA-CHARGING-PWY}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 16:53, 10 January 2018
Gene Tiso_gene_18609
- Synonym(s):
Reactions associated
- ALANINE--TRNA-LIGASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
