Difference between revisions of "PWY-6643"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * inchi key: ** InChIKey=VOKUMXABRRXHA...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5826 PWY-5826] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5826 PWY-5826] ==
* smiles:
+
* taxonomic range:
** CC([CH]=O)C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
* inchi key:
+
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
+
 
* common name:
 
* common name:
** (R)-methylmalonate-semialdehyde
+
** hypoglycin biosynthesis
* molecular weight:
+
** 101.082   
+
 
* Synonym(s):
 
* Synonym(s):
** (R)-2-methyl-3-oxopropanoate
 
** (R)-ch3-malonate-semialdehyde
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
* '''4''' reaction(s) found
== Reaction(s) of unknown directionality ==
+
** [[RXN-15123]]
* [[RXN-14056]]
+
** [[RXN-15122]]
 +
** [[RXN-15121]]
 +
** [[RXN-9157]]
 +
== Reaction(s) not found ==
 +
* '''10''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9174 RXN-9174]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9175 RXN-9175]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9172 RXN-9172]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9173 RXN-9173]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9170 RXN-9170]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9171 RXN-9171]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9169 RXN-9169]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9168 RXN-9168]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9167 RXN-9167]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9189 RXN-9189]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3193}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
+
{{#set: common name=hypoglycin biosynthesis}}
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
+
{{#set: reaction found=4}}
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
+
{{#set: reaction not found=10}}
{{#set: common name=(R)-methylmalonate-semialdehyde}}
+
{{#set: molecular weight=101.082    }}
+
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
+
{{#set: consumed or produced by=RXN-14056}}
+

Revision as of 15:41, 10 January 2018

Pathway PWY-5826

  • taxonomic range:
  • common name:
    • hypoglycin biosynthesis
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links