Difference between revisions of "2-ACETO-2-HYDROXY-BUTYRATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLETIN SCOPOLETIN] == * smiles: ** COC2(C=C1(C(OC(=O)C=C1)=CC=2O)) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.11.1.12-RXN 1.11.1.12-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.11.1.12-RXN 1.11.1.12-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.11.1.12 EC-1.11.1.12] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[A-LIPID-HYDROPEROXIDE]][c] '''+''' 2 [[GLUTATHIONE]][c] '''=>''' 1 [[Lipid-hydroxy-fatty-acids]][c] '''+''' 1 [[OXIDIZED-GLUTATHIONE]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a hydroperoxy-fatty-acyl-[lipid][c] '''+''' 2 glutathione[c] '''=>''' 1 a hydroxy-fatty-acyl-[lipid][c] '''+''' 1 glutathione disulfide[c] '''+''' 1 H2O[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-4081]], glutathione-peroxide redox reactions: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4081 PWY-4081] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[experimental_annotation]] | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03167 R03167] | |
− | + | * UNIPROT: | |
− | + | ** [http://www.uniprot.org/uniprot/O23814 O23814] | |
− | + | ** [http://www.uniprot.org/uniprot/O48646 O48646] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.11.1.12}} |
− | * | + | {{#set: in pathway=PWY-4081}} |
− | ** [http://www. | + | {{#set: reconstruction category=annotation}} |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | ** [http://www. | + | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:54, 10 January 2018
Contents
Reaction 1.11.1.12-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 A-LIPID-HYDROPEROXIDE[c] + 2 GLUTATHIONE[c] => 1 Lipid-hydroxy-fatty-acids[c] + 1 OXIDIZED-GLUTATHIONE[c] + 1 WATER[c]
- With common name(s):
- 1 a hydroperoxy-fatty-acyl-[lipid][c] + 2 glutathione[c] => 1 a hydroxy-fatty-acyl-[lipid][c] + 1 glutathione disulfide[c] + 1 H2O[c]
Genes associated with this reaction
Pathways
- PWY-4081, glutathione-peroxide redox reactions: PWY-4081
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
External links