Difference between revisions of "Tiso gene 10811"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-MANNOSE DTDP-DEOH-DEOXY-MANNOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-MANNOSE DTDP-DEOH-DEOXY-MANNOSE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PSXWNITXWWECNY-LPVGZGSHSA-L |
* common name: | * common name: | ||
− | ** | + | ** dTDP-4-dehydro-β-L-rhamnose |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 544.302 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** dTDP-4-oxo-6-deoxy-β-L-mannose |
− | + | ** dTDP-4-oxo-β-L-rhamnose | |
− | ** | + | ** dTDP-4-dehydro-6-deoxy-β-L-mannose |
− | ** | + | ** dTDP-4-keto-L-rhamnose |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DTDPDEHYRHAMREDUCT-RXN]] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356769 53356769] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62830 62830] |
− | * | + | * BIGG : dtdp4d6dm |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00688 C00688] |
− | {{#set: common name= | + | {{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=PSXWNITXWWECNY-LPVGZGSHSA-L}} |
− | {{#set: common name= | + | {{#set: common name=dTDP-4-dehydro-β-L-rhamnose}} |
− | + | {{#set: molecular weight=544.302 }} | |
− | {{#set: | + | {{#set: common name=dTDP-4-oxo-6-deoxy-β-L-mannose|dTDP-4-oxo-β-L-rhamnose|dTDP-4-dehydro-6-deoxy-β-L-mannose|dTDP-4-keto-L-rhamnose}} |
+ | {{#set: consumed by=DTDPDEHYRHAMREDUCT-RXN}} |
Revision as of 16:56, 10 January 2018
Contents
Metabolite DTDP-DEOH-DEOXY-MANNOSE
- smiles:
- CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))
- inchi key:
- InChIKey=PSXWNITXWWECNY-LPVGZGSHSA-L
- common name:
- dTDP-4-dehydro-β-L-rhamnose
- molecular weight:
- 544.302
- Synonym(s):
- dTDP-4-oxo-6-deoxy-β-L-mannose
- dTDP-4-oxo-β-L-rhamnose
- dTDP-4-dehydro-6-deoxy-β-L-mannose
- dTDP-4-keto-L-rhamnose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))" cannot be used as a page name in this wiki.