Difference between revisions of "RXN0-6490"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_20353 == * left end position: ** 1 * transcription direction: ** POSITIVE * right end position: ** 151 * centisome position: ** 6.765900e-2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O * inchi...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L |
| − | * | + | * common name: |
| − | ** | + | ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 450.508 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-16118]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820233 91820233] |
| − | {{#set: | + | {{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L}} |
| − | {{#set: | + | {{#set: common name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}} |
| − | {{#set: | + | {{#set: molecular weight=450.508 }} |
| + | {{#set: consumed by=RXN-16118}} | ||
Revision as of 17:57, 10 January 2018
Contents
Metabolite CPD-17372
- smiles:
- C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
- inchi key:
- InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L
- common name:
- 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
- molecular weight:
- 450.508
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.
"1-[18-hydroxyoleyl]-2-lyso-phosphatidate" cannot be used as a page name in this wiki.
