Difference between revisions of "ATID"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8585 == * left end position: ** 6090 * transcription direction: ** POSITIVE * right end position: ** 7539 * centisome position: ** 60.38072...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N |
| − | * | + | * common name: |
| − | ** | + | ** nicotine-1'-N-oxide |
| − | * | + | * molecular weight: |
| − | ** | + | ** 178.233 |
* Synonym(s): | * Synonym(s): | ||
| + | ** nicotine N'-oxide | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-81]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68107 68107] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.61415.html 61415] |
| − | {{#set: | + | * HMDB : HMDB01497 |
| − | {{#set: | + | {{#set: smiles=C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))}} |
| + | {{#set: inchi key=InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N}} | ||
| + | {{#set: common name=nicotine-1'-N-oxide}} | ||
| + | {{#set: molecular weight=178.233 }} | ||
| + | {{#set: common name=nicotine N'-oxide}} | ||
| + | {{#set: produced by=RXN66-81}} | ||
Revision as of 16:57, 10 January 2018
Contents
Metabolite CPD-2743
- smiles:
- C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
- inchi key:
- InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
- common name:
- nicotine-1'-N-oxide
- molecular weight:
- 178.233
- Synonym(s):
- nicotine N'-oxide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))" cannot be used as a page name in this wiki.
