Difference between revisions of "SALICYLALDEHYDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] == * smiles: ** C(=O)([O-])OP([O-])(=O)O * inchi key: ** InChIKey=LQQCGEGR...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-132 RXN1G-132] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta21-3-oxo-C40:1-[ac...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-132 RXN1G-132] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])OP([O-])(=O)O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** carboxyphosphate
+
** cis-delta21-3-oxo-C40:1-[acyl-carrier protein] synthase
−
* molecular weight:
+
* ec number:
−
** 139.989   
+
** [http://enzyme.expasy.org/EC/2.3.1.M1 EC-2.3.1.M1]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16910]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[MALONYL-ACP]][c] '''+''' 1 [[cis-delta19-C38-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[cis-delta21-3-oxo-C40-ACPs]][c]
−
* [[RXN-16909]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a malonyl-[acp][c] '''+''' 1 a cis-delta19-C38:1-[acp][c] '''+''' 1 H+[c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c] '''+''' 1 a cis-delta21-3-oxo-C40:1-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_14485]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_15991]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_19302]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826591 91826591]
+
{{#set: common name=cis-delta21-3-oxo-C40:1-[acyl-carrier protein] synthase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-2.3.1.M1}}
−
** [http://www.chemspider.com/Chemical-Structure.169776.html 169776]
+
{{#set: gene associated=Tiso_gene_14485|Tiso_gene_15991|Tiso_gene_19302}}
−
* CHEBI:
+
{{#set: in pathway=PWYG-321}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86994 86994]
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=C(=O)([O-])OP([O-])(=O)O}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L}}
+
{{#set: reconstruction source=esiliculosus}}
−
{{#set: common name=carboxyphosphate}}
+
−
{{#set: molecular weight=139.989    }}
+
−
{{#set: consumed by=RXN-16910}}
+
−
{{#set: produced by=RXN-16909}}
+

Revision as of 16:58, 10 January 2018

Reaction RXN1G-132

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis-delta21-3-oxo-C40:1-[acyl-carrier protein] synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis-delta21-3-oxo-C40:1-[acyl-carrier protein] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=SALICYLALDEHYDE&oldid=15480"