Difference between revisions of "Unwound-DNA"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=COLANSYN-PWY COLANSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-122...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] == * smiles: ** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C |
| + | * inchi key: | ||
| + | ** InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** torulene |
| + | * molecular weight: | ||
| + | ** 534.867 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3',4'-didehydro-β,ψ-carotene | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-11989]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10218186 10218186] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.8393678.html 8393678] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9638 9638] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C08613 C08613] | ||
| + | {{#set: smiles=CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C}} | ||
| + | {{#set: inchi key=InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N}} | ||
| + | {{#set: common name=torulene}} | ||
| + | {{#set: molecular weight=534.867 }} | ||
| + | {{#set: common name=3',4'-didehydro-β,ψ-carotene}} | ||
| + | {{#set: consumed by=RXN-11989}} | ||
Revision as of 15:42, 10 January 2018
Contents
Metabolite CPD-7953
- smiles:
- CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C
- inchi key:
- InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N
- common name:
- torulene
- molecular weight:
- 534.867
- Synonym(s):
- 3',4'-didehydro-β,ψ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
