Difference between revisions of "RXN-1104"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(=C(O2)C=C(O)C(O)=C(O)3))) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=S...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == |
* smiles: | * smiles: | ||
| − | ** C1( | + | ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O |
* common name: | * common name: | ||
| − | ** | + | ** (S)-nicotine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 163.242 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** nicotine |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-81]] |
| + | * [[RXN66-146]] | ||
| + | * [[RXN66-83]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * NCI: |
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5065 5065] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6919000 6919000] |
| − | * HMDB : | + | * HMDB : HMDB01934 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00745 C00745] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.5294163.html 5294163] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59806 59806] |
| − | + | {{#set: smiles=C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))}} | |
| − | {{#set: smiles=C1( | + | {{#set: inchi key=InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=(S)-nicotine}} |
| − | {{#set: common name= | + | {{#set: molecular weight=163.242 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=nicotine}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN66-81|RXN66-146|RXN66-83}} |
| − | {{#set: consumed by= | + | |
Revision as of 17:00, 10 January 2018
Contents
Metabolite NICOTINE
- smiles:
- C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))
- inchi key:
- InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O
- common name:
- (S)-nicotine
- molecular weight:
- 163.242
- Synonym(s):
- nicotine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.
