Difference between revisions of "RXN1F-144"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...") |
(Created page with "Category:Gene == Gene Tiso_gene_14113 == * left end position: ** 2 * transcription direction: ** NEGATIVE * right end position: ** 3559 * centisome position: ** 3.42817960...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14113 == |
− | * | + | * left end position: |
− | ** | + | ** 2 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3559 |
− | * | + | * centisome position: |
− | ** | + | ** 3.428179600e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[ADENOSINETRIPHOSPHATASE-RXN]] |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | * [[ | + | * [[ATPASE-RXN]] |
− | == | + | ** in-silico_annotation |
+ | ***ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3559}} | |
− | + | {{#set: centisome position=3.428179600e-2}} | |
− | + | {{#set: reaction associated=ADENOSINETRIPHOSPHATASE-RXN|ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 17:00, 10 January 2018
Gene Tiso_gene_14113
- left end position:
- 2
- transcription direction:
- NEGATIVE
- right end position:
- 3559
- centisome position:
- 3.428179600e-2
- Synonym(s):
Reactions associated
- ADENOSINETRIPHOSPHATASE-RXN
- ATPASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation