Difference between revisions of "TETRAACYLDISACC4KIN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CO)(O)C(O)C(O)1) * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_8525 == * left end position: ** 6380 * transcription direction: ** POSITIVE * right end position: ** 8687 * centisome position: ** 62.71503...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8525 == |
− | * | + | * left end position: |
− | ** | + | ** 6380 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 8687 |
− | * | + | * centisome position: |
− | ** | + | ** 62.71503 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-15122]] |
− | + | ** in-silico_annotation | |
− | * | + | ***ec-number |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | * | + | * [[THREDEHYD-RXN]] |
− | * | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | + | == Pathways associated == | |
− | + | * [[PWY66-428]] | |
− | * [[ | + | * [[ILEUSYN-PWY]] |
− | * | + | * [[PWY-5826]] |
− | * | + | * [[PWY-5437]] |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6380}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=8687}} | |
− | + | {{#set: centisome position=62.71503 }} | |
− | + | {{#set: reaction associated=RXN-15122|THREDEHYD-RXN}} | |
− | + | {{#set: pathway associated=PWY66-428|ILEUSYN-PWY|PWY-5826|PWY-5437}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 17:01, 10 January 2018
Gene Tiso_gene_8525
- left end position:
- 6380
- transcription direction:
- POSITIVE
- right end position:
- 8687
- centisome position:
- 62.71503
- Synonym(s):
Reactions associated
- RXN-15122
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- THREDEHYD-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation