Difference between revisions of "KYNURENINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * smiles: ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUCURONOKINASE-RXN GLUCURONOKINASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucuro...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUCURONOKINASE-RXN GLUCURONOKINASE-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Glucuronokinase 1 |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.43 EC-2.7.1.43] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | == | + | ** 1 [[D-Glucopyranuronate]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[CPD-510]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 D-glucopyranuronate[c] '''+''' 1 ATP[c] '''=>''' 1 α-D-glucuronate 1-phosphate[c] '''+''' 1 ADP[c] '''+''' 1 H+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_12190]] | ||
| + | ** EXPERIMENTAL_ANNOTATION | ||
| + | ***AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-4841]], UDP-α-D-glucuronate biosynthesis (from myo-inositol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4841 PWY-4841] | ||
| + | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[experimental_annotation]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17005 17005] | |
| − | + | * LIGAND-RXN: | |
| − | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01476 R01476] |
| − | * | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | + | {{#set: common name=Glucuronokinase 1}} | |
| − | ** [http:// | + | {{#set: ec number=EC-2.7.1.43}} |
| − | + | {{#set: gene associated=Tiso_gene_12190}} | |
| − | {{#set: | + | {{#set: in pathway=PWY-4841}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | {{#set: reconstruction source=experimental_annotation}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:02, 10 January 2018
Contents
Reaction GLUCURONOKINASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Glucuronokinase 1
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 D-Glucopyranuronate[c] + 1 ATP[c] => 1 CPD-510[c] + 1 ADP[c] + 1 PROTON[c]
- With common name(s):
- 1 D-glucopyranuronate[c] + 1 ATP[c] => 1 α-D-glucuronate 1-phosphate[c] + 1 ADP[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_12190
- EXPERIMENTAL_ANNOTATION
- AUTOMATED-NAME-MATCH
- EXPERIMENTAL_ANNOTATION
Pathways
- PWY-4841, UDP-α-D-glucuronate biosynthesis (from myo-inositol): PWY-4841
- 2 reactions found over 3 reactions in the full pathway
Reconstruction information
External links
