Difference between revisions of "Tiso gene 6495"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17352 RXN-17352] == * direction: ** LEFT-TO-RIGHT * common name: ** ascorbate_peroxidase ** ORF...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-181 CPD0-181] == * smiles: ** C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17352 RXN-17352] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-181 CPD0-181] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)
 +
* inchi key:
 +
** InChIKey=JHLXDWGVSYMXPL-XVFCMESISA-K
 
* common name:
 
* common name:
−
** ascorbate_peroxidase
+
** N5-carboxyaminoimidazole ribonucleotide
−
** ORF
+
* molecular weight:
−
* ec number:
+
** 336.174   
−
** [http://enzyme.expasy.org/EC/1.11.1.7 EC-1.11.1.7]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole
 +
** 5-phosphoribosyl-5-carboxyaminoimidazole
 +
** N5-CAIR
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 2 [[CONIFERYL-ALCOHOL]][c] '''=>''' 2 [[WATER]][c] '''+''' 2 [[CPD-18761]][c]
+
* [[RXN0-742]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 hydrogen peroxide[c] '''+''' 2 coniferyl alcohol[c] '''=>''' 2 H2O[c] '''+''' 2 coniferyl alcohol radical[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_11016]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_15820]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_15962]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6824]], justicidin B biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6824 PWY-6824]
+
−
** '''1''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-5466]], matairesinol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5466 PWY-5466]
+
−
** '''1''' reactions found over '''10''' reactions in the full pathway
+
−
* [[PWY-5469]], sesamin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5469 PWY-5469]
+
−
** '''1''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=ascorbate_peroxidase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15667 C15667]
−
{{#set: common name=ORF}}
+
* CHEBI:
−
{{#set: ec number=EC-1.11.1.7}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58730 58730]
−
{{#set: gene associated=Tiso_gene_11016|Tiso_gene_15820|Tiso_gene_15962}}
+
* BIGG : 5caiz
−
{{#set: in pathway=PWY-6824|PWY-5466|PWY-5469}}
+
* PUBCHEM:
−
{{#set: reconstruction category=annotation}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202011 25202011]
−
{{#set: reconstruction tool=pathwaytools}}
+
* HMDB : HMDB12268
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: smiles=C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)}}
 +
{{#set: inchi key=InChIKey=JHLXDWGVSYMXPL-XVFCMESISA-K}}
 +
{{#set: common name=N5-carboxyaminoimidazole ribonucleotide}}
 +
{{#set: molecular weight=336.174    }}
 +
{{#set: common name=5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole|5-phosphoribosyl-5-carboxyaminoimidazole|N5-CAIR}}
 +
{{#set: produced by=RXN0-742}}

Revision as of 17:02, 10 January 2018

Metabolite CPD0-181

  • smiles:
    • C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)
  • inchi key:
    • InChIKey=JHLXDWGVSYMXPL-XVFCMESISA-K
  • common name:
    • N5-carboxyaminoimidazole ribonucleotide
  • molecular weight:
    • 336.174
  • Synonym(s):
    • 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole
    • 5-phosphoribosyl-5-carboxyaminoimidazole
    • N5-CAIR

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6495&oldid=15801"