Difference between revisions of "Tiso gene 6190"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_17309 == * left end position: ** 1715 * transcription direction: ** NEGATIVE * right end position: ** 3727 * centisome position: ** 45.2029...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17309 == |
− | * | + | * left end position: |
− | ** | + | ** 1715 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3727 |
− | * | + | * centisome position: |
− | ** | + | ** 45.202953 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[ACID-PHOSPHATASE-RXN]] |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
− | * [[ | + | * [[RXN-5822]] |
− | * [[ | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-6348]] | |
+ | * [[PWY-5083]] | ||
+ | * [[NADPHOS-DEPHOS-PWY]] | ||
+ | * [[NAD-BIOSYNTHESIS-II]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1715}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3727}} | |
− | + | {{#set: centisome position=45.202953 }} | |
− | + | {{#set: reaction associated=ACID-PHOSPHATASE-RXN|RXN-5822}} | |
− | + | {{#set: pathway associated=PWY-6348|PWY-5083|NADPHOS-DEPHOS-PWY|NAD-BIOSYNTHESIS-II}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:02, 10 January 2018
Gene Tiso_gene_17309
- left end position:
- 1715
- transcription direction:
- NEGATIVE
- right end position:
- 3727
- centisome position:
- 45.202953
- Synonym(s):
Reactions associated
- ACID-PHOSPHATASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-5822
- in-silico_annotation
- ec-number
- in-silico_annotation