Difference between revisions of "Tiso gene 18092"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * smiles: ** C(OP([O-])(=O)[O-])C([O-])=O * inchi key: ** InChIKey=ASCFNMCAHF...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11374 RXN-11374] == * direction: ** LEFT-TO-RIGHT * common name: ** diphthine_synthase * Synony...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11374 RXN-11374] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** diphthine_synthase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-]][c] '''=>''' 1 [[3-carboxy-3-dimethylammonio-propyl-L-his]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] |
− | == | + | * With common name(s): |
+ | ** 1 S-adenosyl-L-methionine[c] '''+''' 1 a 2-[(3S)-3-carboxy-3-(methylammonio)propyl]-L-histidine-[translation elongation factor 2][c] '''=>''' 1 a 2-[(3S)-3-carboxy-3-(dimethylammonio)propyl]-L-histidine-[translation elongation factor 2][c] '''+''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_15743]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[esiliculosus]] | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08468 R08468] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=diphthine_synthase}} | |
− | * LIGAND- | + | {{#set: gene associated=Tiso_gene_15743}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=}} |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | {{#set: reconstruction source=esiliculosus}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | {{#set: reconstruction source=in-silico_annotation}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:03, 10 January 2018
Contents
Reaction RXN-11374
- direction:
- LEFT-TO-RIGHT
- common name:
- diphthine_synthase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-ADENOSYLMETHIONINE[c] + 1 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-[c] => 1 3-carboxy-3-dimethylammonio-propyl-L-his[c] + 1 PROTON[c] + 1 ADENOSYL-HOMO-CYS[c]
- With common name(s):
- 1 S-adenosyl-L-methionine[c] + 1 a 2-[(3S)-3-carboxy-3-(methylammonio)propyl]-L-histidine-[translation elongation factor 2][c] => 1 a 2-[(3S)-3-carboxy-3-(dimethylammonio)propyl]-L-histidine-[translation elongation factor 2][c] + 1 H+[c] + 1 S-adenosyl-L-homocysteine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_15743
- IN-SILICO_ANNOTATION
- EC-NUMBER
- pantograph-esiliculosus
- IN-SILICO_ANNOTATION
Pathways
Reconstruction information
External links
- LIGAND-RXN: