Difference between revisions of "Tiso gene 16166"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2448 == * left end position: ** 4639 * transcription direction: ** POSITIVE * right end position: ** 6403 * centisome position: ** 23.90621...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14300 CPD-14300] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14300 CPD-14300] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 3-oxo-(11Z)-eicos-11-enoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1069.99 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14484]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-13322]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581100 71581100] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74011 74011] |
| − | {{#set: | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J}} |
| + | {{#set: common name=3-oxo-(11Z)-eicos-11-enoyl-CoA}} | ||
| + | {{#set: molecular weight=1069.99 }} | ||
| + | {{#set: consumed by=RXN-14484}} | ||
| + | {{#set: produced by=RXN-13322}} | ||
Revision as of 17:03, 10 January 2018
Contents
Metabolite CPD-14300
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J
- common name:
- 3-oxo-(11Z)-eicos-11-enoyl-CoA
- molecular weight:
- 1069.99
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
