Difference between revisions of "Tiso gene 16455"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=LHFJO...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-306 RXN1G-306] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta7-3-oxo-C26:1-[acy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-306 RXN1G-306] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cis-delta7-3-oxo-C26:1-[acyl-carrier protein] synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.M1 EC-2.3.1.M1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[1 | + | ** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[cis-delta5-lignoceroyl-ACPs]][c] '''=>''' 1 [[cis-delta7-3-oxo-cerotoyl-ACPs]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 a cis-delta5-C24:1-[acp][c] '''=>''' 1 a cis-delta7-3-oxo-C26:1-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_15991]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_14485]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_19302]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
+ | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=cis-delta7-3-oxo-C26:1-[acyl-carrier protein] synthase}} | |
− | + | {{#set: ec number=EC-2.3.1.M1}} | |
− | + | {{#set: gene associated=Tiso_gene_15991|Tiso_gene_14485|Tiso_gene_19302}} | |
− | + | {{#set: in pathway=PWYG-321}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | {{#set: reconstruction source=esiliculosus}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:04, 10 January 2018
Contents
Reaction RXN1G-306
- direction:
- LEFT-TO-RIGHT
- common name:
- cis-delta7-3-oxo-C26:1-[acyl-carrier protein] synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 MALONYL-ACP[c] + 1 cis-delta5-lignoceroyl-ACPs[c] => 1 cis-delta7-3-oxo-cerotoyl-ACPs[c] + 1 ACP[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 H+[c] + 1 a malonyl-[acp][c] + 1 a cis-delta5-C24:1-[acp][c] => 1 a cis-delta7-3-oxo-C26:1-[acp][c] + 1 a holo-[acyl-carrier protein][c] + 1 CO2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
"cis-delta7-3-oxo-C26:1-[acyl-carrier protein] synthase" cannot be used as a page name in this wiki.